About azane;diethylcarbamodithioic acid;hydrate
azane;diethylcarbamodithioic acid;hydrate (PubChem CID 174606289) has the molecular formula C5H19N3OS2
and a molecular weight of 201.36 g/mol. Its IUPAC name is azane;diethylcarbamodithioic acid;hydrate.
Molecular Properties
| Compound Name | azane;diethylcarbamodithioic acid;hydrate |
| PubChem CID | 174606289 |
| Molecular Formula | C5H19N3OS2 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | azane;diethylcarbamodithioic acid;hydrate |
| SMILES | CCN(CC)C(=S)S.N.N.O |
| InChI | InChI=1S/C5H11NS2.2H3N.H2O/c1-3-6(4-2)5(7)8;;;/h3-4H2,1-2H3,(H,7,8);2*1H3;1H2 |
| InChIKey | JNROVYNGOLPBFL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;diethylcarbamodithioic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;diethylcarbamodithioic acid;hydrate?
The IUPAC name of azane;diethylcarbamodithioic acid;hydrate (CID 174606289) is azane;diethylcarbamodithioic acid;hydrate.
What is the SMILES notation for azane;diethylcarbamodithioic acid;hydrate?
The canonical SMILES for azane;diethylcarbamodithioic acid;hydrate is CCN(CC)C(=S)S.N.N.O.
What is the InChIKey of azane;diethylcarbamodithioic acid;hydrate?
The InChIKey is JNROVYNGOLPBFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NS2.2H3N.H2O/c1-3-6(4-2)5(7)8;;;/h3-4H2,1-2H3,(H,7,8);2*1H3;1H2.
What are the key properties of azane;diethylcarbamodithioic acid;hydrate?
azane;diethylcarbamodithioic acid;hydrate has a molecular weight of 201.36 g/mol, XLogP of 1.04, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;diethylcarbamodithioic acid;hydrate is sourced from PubChem (CID 174606289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).