About CID 157101395
CID 157101395 (PubChem CID 157101395) has the molecular formula C5H11NS2Se
and a molecular weight of 228.24 g/mol.
Molecular Properties
| Compound Name | CID 157101395 |
| PubChem CID | 157101395 |
| Molecular Formula | C5H11NS2Se |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.95 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=S)S.[Se] |
| InChI | InChI=1S/C5H11NS2.Se/c1-3-6(4-2)5(7)8;/h3-4H2,1-2H3,(H,7,8); |
| InChIKey | AFUNIRHCANXNRU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 157101395 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157101395?
The IUPAC name of CID 157101395 (CID 157101395) is not available.
What is the SMILES notation for CID 157101395?
The canonical SMILES for CID 157101395 is CCN(CC)C(=S)S.[Se].
What is the InChIKey of CID 157101395?
The InChIKey is AFUNIRHCANXNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NS2.Se/c1-3-6(4-2)5(7)8;/h3-4H2,1-2H3,(H,7,8);.
What are the key properties of CID 157101395?
CID 157101395 has a molecular weight of 228.24 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157101395 is sourced from PubChem (CID 157101395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).