C5H10NS2- — CID 28343
N,N-diethylcarbamodithioate (PubChem CID 28343) has the molecular formula C5H10NS2- and a molecular weight of 148.28 g/mol. Its IUPAC name is N,N-diethylcarbamodithioate.
| Compound Name | N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 28343 |
| Molecular Formula | C5H10NS2- |
| Molecular Weight | 148.28 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)[S-] |
| InChI | InChI=1S/C5H11NS2/c1-3-6(4-2)5(7)8/h3-4H2,1-2H3,(H,7,8)/p-1 |
| InChIKey | LMBWSYZSUOEYSN-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|