About Diethyldithiocarbamate
Diethyldithiocarbamate (PubChem CID 28343) has the molecular formula C5H10NS2-
and a molecular weight of 148.30 g/mol. Its IUPAC name is N,N-diethylcarbamodithioate.
Molecular Properties
| Compound Name | Diethyldithiocarbamate |
| PubChem CID | 28343 |
| Molecular Formula | C5H10NS2- |
| Molecular Weight | 148.30 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)[S-] |
| InChI | InChI=1S/C5H11NS2/c1-3-6(4-2)5(7)8/h3-4H2,1-2H3,(H,7,8)/p-1 |
| InChIKey | LMBWSYZSUOEYSN-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 36.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | 73 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze Diethyldithiocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diethyldithiocarbamate?
The IUPAC name of Diethyldithiocarbamate (CID 28343) is N,N-diethylcarbamodithioate.
What is the SMILES notation for Diethyldithiocarbamate?
The canonical SMILES for Diethyldithiocarbamate is CCN(CC)C(=S)[S-].
What is the InChIKey of Diethyldithiocarbamate?
The InChIKey is LMBWSYZSUOEYSN-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H11NS2/c1-3-6(4-2)5(7)8/h3-4H2,1-2H3,(H,7,8)/p-1.
What are the key properties of Diethyldithiocarbamate?
Diethyldithiocarbamate has a molecular weight of 148.30 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Diethyldithiocarbamate is sourced from PubChem (CID 28343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).