sodium N,N-dipropylcarbamodithioate

C7H14NNaS2 — CID 539731

IUPACsodium N,N-dipropylcarbamodithioate
SMILESCCCN(CCC)C(=S)[S-].[Na+]
InChIInChI=1S/C7H15NS2.Na/c1-3-5-8(6-4-2)7(9)10;/h3-6H2,1-2H3,(H,9,10);/q;+1/p-1
InChIKeyILNWEIMZWZNAKF-UHFFFAOYSA-M
MW199.32 g/mol
LogP-1.06
Rot. Bonds4

About sodium N,N-dipropylcarbamodithioate

sodium N,N-dipropylcarbamodithioate (PubChem CID 539731) has the molecular formula C7H14NNaS2 and a molecular weight of 199.32 g/mol. Its IUPAC name is sodium N,N-dipropylcarbamodithioate.

Molecular Properties

Compound Namesodium N,N-dipropylcarbamodithioate
PubChem CID539731
Molecular FormulaC7H14NNaS2
Molecular Weight199.32 g/mol
Exact Mass199.05
IUPAC Namesodium N,N-dipropylcarbamodithioate
SMILESCCCN(CCC)C(=S)[S-].[Na+]
InChIInChI=1S/C7H15NS2.Na/c1-3-5-8(6-4-2)7(9)10;/h3-6H2,1-2H3,(H,9,10);/q;+1/p-1
InChIKeyILNWEIMZWZNAKF-UHFFFAOYSA-M
XLogP-1.06
TPSA3.24 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.32
LogP ≤ 5-1.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}

Analyze sodium N,N-dipropylcarbamodithioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium N,N-dipropylcarbamodithioate?
The IUPAC name of sodium N,N-dipropylcarbamodithioate (CID 539731) is sodium N,N-dipropylcarbamodithioate.
What is the SMILES notation for sodium N,N-dipropylcarbamodithioate?
The canonical SMILES for sodium N,N-dipropylcarbamodithioate is CCCN(CCC)C(=S)[S-].[Na+].
What is the InChIKey of sodium N,N-dipropylcarbamodithioate?
The InChIKey is ILNWEIMZWZNAKF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H15NS2.Na/c1-3-5-8(6-4-2)7(9)10;/h3-6H2,1-2H3,(H,9,10);/q;+1/p-1.
What are the key properties of sodium N,N-dipropylcarbamodithioate?
sodium N,N-dipropylcarbamodithioate has a molecular weight of 199.32 g/mol, XLogP of -1.06, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N,N-dipropylcarbamodithioate is sourced from PubChem (CID 539731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).