C7H14NNaS2 — CID 539731
sodium N,N-dipropylcarbamodithioate (PubChem CID 539731) has the molecular formula C7H14NNaS2 and a molecular weight of 199.32 g/mol. Its IUPAC name is sodium N,N-dipropylcarbamodithioate.
| Compound Name | sodium N,N-dipropylcarbamodithioate |
|---|---|
| PubChem CID | 539731 |
| Molecular Formula | C7H14NNaS2 |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | sodium N,N-dipropylcarbamodithioate |
| SMILES | CCCN(CCC)C(=S)[S-].[Na+] |
| InChI | InChI=1S/C7H15NS2.Na/c1-3-5-8(6-4-2)7(9)10;/h3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | ILNWEIMZWZNAKF-UHFFFAOYSA-M |
| XLogP | -1.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|