About CID 6330227
CID 6330227 (PubChem CID 6330227) has the molecular formula C17H20NS2Sb-
and a molecular weight of 424.25 g/mol.
Molecular Properties
| Compound Name | CID 6330227 |
| PubChem CID | 6330227 |
| Molecular Formula | C17H20NS2Sb- |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=S)[S-].c1ccc([Sb]c2ccccc2)cc1 |
| InChI | InChI=1S/2C6H5.C5H11NS2.Sb/c2*1-2-4-6-5-3-1;1-3-6(4-2)5(7)8;/h2*1-5H;3-4H2,1-2H3,(H,7,8);/p-1 |
| InChIKey | YOZUKTCDDDMERA-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 6330227 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6330227?
The IUPAC name of CID 6330227 (CID 6330227) is not available.
What is the SMILES notation for CID 6330227?
The canonical SMILES for CID 6330227 is CCN(CC)C(=S)[S-].c1ccc([Sb]c2ccccc2)cc1.
What is the InChIKey of CID 6330227?
The InChIKey is YOZUKTCDDDMERA-UHFFFAOYSA-M. The full InChI is InChI=1S/2C6H5.C5H11NS2.Sb/c2*1-2-4-6-5-3-1;1-3-6(4-2)5(7)8;/h2*1-5H;3-4H2,1-2H3,(H,7,8);/p-1.
What are the key properties of CID 6330227?
CID 6330227 has a molecular weight of 424.25 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6330227 is sourced from PubChem (CID 6330227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).