C30H28N2S4Zn-2 — CID 4641127
bis(N,N-dibenzylcarbamodithioate);zinc (PubChem CID 4641127) has the molecular formula C30H28N2S4Zn-2 and a molecular weight of 610.23 g/mol. Its IUPAC name is bis(N,N-dibenzylcarbamodithioate);zinc.
| Compound Name | bis(N,N-dibenzylcarbamodithioate);zinc |
|---|---|
| PubChem CID | 4641127 |
| Molecular Formula | C30H28N2S4Zn-2 |
| Molecular Weight | 610.23 g/mol |
| Exact Mass | 608.04 |
| IUPAC Name | bis(N,N-dibenzylcarbamodithioate);zinc |
| SMILES | S=C([S-])N(Cc1ccccc1)Cc1ccccc1.S=C([S-])N(Cc1ccccc1)Cc1ccccc1.[Zn] |
| InChI | InChI=1S/2C15H15NS2.Zn/c2*17-15(18)16(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;/h2*1-10H,11-12H2,(H,17,18);/p-2 |
| InChIKey | CIUNZCLHKCHUSH-UHFFFAOYSA-L |
| XLogP | 7.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.23 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|