About bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+)
bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+) (PubChem CID 172834720) has the molecular formula C22H28CoN2S4
and a molecular weight of 507.68 g/mol. Its IUPAC name is bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+).
Molecular Properties
| Compound Name | bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+) |
| PubChem CID | 172834720 |
| Molecular Formula | C22H28CoN2S4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+) |
| SMILES | CC(C)N(Cc1ccccc1)C(=S)[S-].CC(C)N(Cc1ccccc1)C(=S)[S-].[Co+2] |
| InChI | InChI=1S/2C11H15NS2.Co/c2*1-9(2)12(11(13)14)8-10-6-4-3-5-7-10;/h2*3-7,9H,8H2,1-2H3,(H,13,14);/q;;+2/p-2 |
| InChIKey | VZNZKBXPEAWLER-UHFFFAOYSA-L |
| XLogP | 5.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+)?
The IUPAC name of bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+) (CID 172834720) is bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+).
What is the SMILES notation for bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+)?
The canonical SMILES for bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+) is CC(C)N(Cc1ccccc1)C(=S)[S-].CC(C)N(Cc1ccccc1)C(=S)[S-].[Co+2].
What is the InChIKey of bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+)?
The InChIKey is VZNZKBXPEAWLER-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H15NS2.Co/c2*1-9(2)12(11(13)14)8-10-6-4-3-5-7-10;/h2*3-7,9H,8H2,1-2H3,(H,13,14);/q;;+2/p-2.
What are the key properties of bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+)?
bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+) has a molecular weight of 507.68 g/mol, XLogP of 5.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-benzyl-N-propan-2-ylcarbamodithioate);cobalt(2+) is sourced from PubChem (CID 172834720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).