C18H26N2S — CID 18557022
1-benzyl-3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-1-propan-2-ylthiourea (PubChem CID 18557022) has the molecular formula C18H26N2S and a molecular weight of 302.49 g/mol. Its IUPAC name is 1-benzyl-3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-1-propan-2-ylthiourea.
| Compound Name | 1-benzyl-3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-1-propan-2-ylthiourea |
|---|---|
| PubChem CID | 18557022 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 1-benzyl-3-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-1-propan-2-ylthiourea |
| SMILES | CC(C)N(Cc1ccccc1)C(=S)N[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C18H26N2S/c1-13(2)20(12-14-6-4-3-5-7-14)18(21)19-17-11-15-8-9-16(17)10-15/h3-7,13,15-17H,8-12H2,1-2H3,(H,19,21)/t15-,16-,17+/m1/s1 |
| InChIKey | VHFGOKGIOHVADT-ZACQAIPSSA-N |
| XLogP | 3.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|