C23H28N2S — CID 7858643
1-benzyl-3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-phenylethyl)thiourea (PubChem CID 7858643) has the molecular formula C23H28N2S and a molecular weight of 364.56 g/mol. Its IUPAC name is 1-benzyl-3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-phenylethyl)thiourea.
| Compound Name | 1-benzyl-3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 7858643 |
| Molecular Formula | C23H28N2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-benzyl-3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-(2-phenylethyl)thiourea |
| SMILES | S=C(N[C@@H]1C[C@H]2CC[C@H]1C2)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H28N2S/c26-23(24-22-16-20-11-12-21(22)15-20)25(17-19-9-5-2-6-10-19)14-13-18-7-3-1-4-8-18/h1-10,20-22H,11-17H2,(H,24,26)/t20-,21-,22+/m0/s1 |
| InChIKey | BEBGIKYDQVWKDR-FDFHNCONSA-N |
| XLogP | 4.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|