C17H24N2S — CID 7943565
3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-ethyl-1-(2-methylphenyl)thiourea (PubChem CID 7943565) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-ethyl-1-(2-methylphenyl)thiourea.
| Compound Name | 3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-ethyl-1-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 7943565 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 3-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-1-ethyl-1-(2-methylphenyl)thiourea |
| SMILES | CCN(C(=S)N[C@@H]1C[C@H]2CC[C@H]1C2)c1ccccc1C |
| InChI | InChI=1S/C17H24N2S/c1-3-19(16-7-5-4-6-12(16)2)17(20)18-15-11-13-8-9-14(15)10-13/h4-7,13-15H,3,8-11H2,1-2H3,(H,18,20)/t13-,14-,15+/m0/s1 |
| InChIKey | LPYYFQXISCWLHN-SOUVJXGZSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|