C14H19N — CID 124526668
(1S,2R,4S)-N-(2-methylphenyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 124526668) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (1S,2R,4S)-N-(2-methylphenyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1S,2R,4S)-N-(2-methylphenyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 124526668 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (1S,2R,4S)-N-(2-methylphenyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | Cc1ccccc1N[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H19N/c1-10-4-2-3-5-13(10)15-14-9-11-6-7-12(14)8-11/h2-5,11-12,14-15H,6-9H2,1H3/t11-,12-,14+/m0/s1 |
| InChIKey | IXPHLXKNXZESEE-SGMGOOAPSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |