C14H20N2 — CID 115550589
2-N-(2-bicyclo[2.2.1]heptanyl)-3-methylbenzene-1,2-diamine (PubChem CID 115550589) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-N-(2-bicyclo[2.2.1]heptanyl)-3-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(2-bicyclo[2.2.1]heptanyl)-3-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115550589 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-N-(2-bicyclo[2.2.1]heptanyl)-3-methylbenzene-1,2-diamine |
| SMILES | Cc1cccc(N)c1NC1CC2CCC1C2 |
| InChI | InChI=1S/C14H20N2/c1-9-3-2-4-12(15)14(9)16-13-8-10-5-6-11(13)7-10/h2-4,10-11,13,16H,5-8,15H2,1H3 |
| InChIKey | SZGGFGVEPMSFHB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|