C13H17IN2 — CID 66082516
1-N-(2-bicyclo[2.2.1]heptanyl)-4-iodobenzene-1,2-diamine (PubChem CID 66082516) has the molecular formula C13H17IN2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 1-N-(2-bicyclo[2.2.1]heptanyl)-4-iodobenzene-1,2-diamine.
| Compound Name | 1-N-(2-bicyclo[2.2.1]heptanyl)-4-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 66082516 |
| Molecular Formula | C13H17IN2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 1-N-(2-bicyclo[2.2.1]heptanyl)-4-iodobenzene-1,2-diamine |
| SMILES | Nc1cc(I)ccc1NC1CC2CCC1C2 |
| InChI | InChI=1S/C13H17IN2/c14-10-3-4-12(11(15)7-10)16-13-6-8-1-2-9(13)5-8/h3-4,7-9,13,16H,1-2,5-6,15H2 |
| InChIKey | VNPPZTSILREZDT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|