C11H15IN2O — CID 66064699
4-iodo-1-N-(oxan-4-yl)benzene-1,2-diamine (PubChem CID 66064699) has the molecular formula C11H15IN2O and a molecular weight of 318.16 g/mol. Its IUPAC name is 4-iodo-1-N-(oxan-4-yl)benzene-1,2-diamine.
| Compound Name | 4-iodo-1-N-(oxan-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 66064699 |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 4-iodo-1-N-(oxan-4-yl)benzene-1,2-diamine |
| SMILES | Nc1cc(I)ccc1NC1CCOCC1 |
| InChI | InChI=1S/C11H15IN2O/c12-8-1-2-11(10(13)7-8)14-9-3-5-15-6-4-9/h1-2,7,9,14H,3-6,13H2 |
| InChIKey | XCQOUFNCCRUGPS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|