C12H20N2 — CID 162380718
1-N-cyclopropyl-4-methylbenzene-1,2-diamine;ethane (PubChem CID 162380718) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-N-cyclopropyl-4-methylbenzene-1,2-diamine;ethane.
| Compound Name | 1-N-cyclopropyl-4-methylbenzene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 162380718 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-N-cyclopropyl-4-methylbenzene-1,2-diamine;ethane |
| SMILES | CC.Cc1ccc(NC2CC2)c(N)c1 |
| InChI | InChI=1S/C10H14N2.C2H6/c1-7-2-5-10(9(11)6-7)12-8-3-4-8;1-2/h2,5-6,8,12H,3-4,11H2,1H3;1-2H3 |
| InChIKey | LROARPVVXJJTMV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|