C10H22N2 — CID 144996884
1-N,4-dimethylbenzene-1,2-diamine;ethane;molecular hydrogen (PubChem CID 144996884) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-N,4-dimethylbenzene-1,2-diamine;ethane;molecular hydrogen.
| Compound Name | 1-N,4-dimethylbenzene-1,2-diamine;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 144996884 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-N,4-dimethylbenzene-1,2-diamine;ethane;molecular hydrogen |
| SMILES | CC.CNc1ccc(C)cc1N.[H][H].[H][H] |
| InChI | InChI=1S/C8H12N2.C2H6.2H2/c1-6-3-4-8(10-2)7(9)5-6;1-2;;/h3-5,10H,9H2,1-2H3;1-2H3;2*1H |
| InChIKey | BWBUECVLWLLYHO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|