C9H14N2 — CID 82502533
2-(aminomethyl)-N,4-dimethylaniline (PubChem CID 82502533) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(aminomethyl)-N,4-dimethylaniline.
| Compound Name | 2-(aminomethyl)-N,4-dimethylaniline |
|---|---|
| PubChem CID | 82502533 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-(aminomethyl)-N,4-dimethylaniline |
| SMILES | CNc1ccc(C)cc1CN |
| InChI | InChI=1S/C9H14N2/c1-7-3-4-9(11-2)8(5-7)6-10/h3-5,11H,6,10H2,1-2H3 |
| InChIKey | YIXJXONSSXLOCQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |