C11H15NO2 — CID 20546910
3-[5-methyl-2-(methylamino)phenyl]propanoic acid (PubChem CID 20546910) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-[5-methyl-2-(methylamino)phenyl]propanoic acid.
| Compound Name | 3-[5-methyl-2-(methylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 20546910 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 3-[5-methyl-2-(methylamino)phenyl]propanoic acid |
| SMILES | CNc1ccc(C)cc1CCC(=O)O |
| InChI | InChI=1S/C11H15NO2/c1-8-3-5-10(12-2)9(7-8)4-6-11(13)14/h3,5,7,12H,4,6H2,1-2H3,(H,13,14) |
| InChIKey | UXWRIBOASCDNPS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |