C11H16O5P+ — CID 174848478
dihydroxy(oxo)phosphanium;3-(2,5-dimethylphenyl)propanoic acid (PubChem CID 174848478) has the molecular formula C11H16O5P+ and a molecular weight of 259.22 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;3-(2,5-dimethylphenyl)propanoic acid.
| Compound Name | dihydroxy(oxo)phosphanium;3-(2,5-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 174848478 |
| Molecular Formula | C11H16O5P+ |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | dihydroxy(oxo)phosphanium;3-(2,5-dimethylphenyl)propanoic acid |
| SMILES | Cc1ccc(C)c(CCC(=O)O)c1.O=[P+](O)O |
| InChI | InChI=1S/C11H14O2.HO3P/c1-8-3-4-9(2)10(7-8)5-6-11(12)13;1-4(2)3/h3-4,7H,5-6H2,1-2H3,(H,12,13);(H-,1,2,3)/p+1 |
| InChIKey | YUSGDYDFSOHYCM-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|