C12H15CsO2 — CID 140689556
cesium 4-(2,5-dimethylphenyl)butanoate (PubChem CID 140689556) has the molecular formula C12H15CsO2 and a molecular weight of 324.16 g/mol. Its IUPAC name is cesium 4-(2,5-dimethylphenyl)butanoate.
| Compound Name | cesium 4-(2,5-dimethylphenyl)butanoate |
|---|---|
| PubChem CID | 140689556 |
| Molecular Formula | C12H15CsO2 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | cesium 4-(2,5-dimethylphenyl)butanoate |
| SMILES | Cc1ccc(C)c(CCCC(=O)[O-])c1.[Cs+] |
| InChI | InChI=1S/C12H16O2.Cs/c1-9-6-7-10(2)11(8-9)4-3-5-12(13)14;/h6-8H,3-5H2,1-2H3,(H,13,14);/q;+1/p-1 |
| InChIKey | DWUPQBFBDOWMLX-UHFFFAOYSA-M |
| XLogP | -1.62 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |