C16H28 — CID 177226937
2-butyl-1,4-dimethylbenzene;ethane;ethene (PubChem CID 177226937) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is 2-butyl-1,4-dimethylbenzene;ethane;ethene.
| Compound Name | 2-butyl-1,4-dimethylbenzene;ethane;ethene |
|---|---|
| PubChem CID | 177226937 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 2-butyl-1,4-dimethylbenzene;ethane;ethene |
| SMILES | C=C.CC.CCCCc1cc(C)ccc1C |
| InChI | InChI=1S/C12H18.C2H6.C2H4/c1-4-5-6-12-9-10(2)7-8-11(12)3;2*1-2/h7-9H,4-6H2,1-3H3;1-2H3;1-2H2 |
| InChIKey | SLXVKBFWGXFZQH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|