C14H22O — CID 121277387
1,4-dimethyl-2-(3-propoxypropyl)benzene (PubChem CID 121277387) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 1,4-dimethyl-2-(3-propoxypropyl)benzene.
| Compound Name | 1,4-dimethyl-2-(3-propoxypropyl)benzene |
|---|---|
| PubChem CID | 121277387 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 1,4-dimethyl-2-(3-propoxypropyl)benzene |
| SMILES | CCCOCCCc1cc(C)ccc1C |
| InChI | InChI=1S/C14H22O/c1-4-9-15-10-5-6-14-11-12(2)7-8-13(14)3/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | KDTXJBYFXOXRFK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|