C19H38 — CID 143613706
butane;ethane;1,2,4-trimethylbenzene (PubChem CID 143613706) has the molecular formula C19H38 and a molecular weight of 266.51 g/mol. Its IUPAC name is butane;ethane;1,2,4-trimethylbenzene.
| Compound Name | butane;ethane;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 143613706 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | butane;ethane;1,2,4-trimethylbenzene |
| SMILES | CC.CCCC.CCCC.Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12.2C4H10.C2H6/c1-7-4-5-8(2)9(3)6-7;2*1-3-4-2;1-2/h4-6H,1-3H3;2*3-4H2,1-2H3;1-2H3 |
| InChIKey | LFCGRDQPUDPUFA-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |