C15H22N2 — CID 114245694
1-N-(2-bicyclo[2.2.1]heptanyl)-4-ethylbenzene-1,3-diamine (PubChem CID 114245694) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-N-(2-bicyclo[2.2.1]heptanyl)-4-ethylbenzene-1,3-diamine.
| Compound Name | 1-N-(2-bicyclo[2.2.1]heptanyl)-4-ethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 114245694 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-N-(2-bicyclo[2.2.1]heptanyl)-4-ethylbenzene-1,3-diamine |
| SMILES | CCc1ccc(NC2CC3CCC2C3)cc1N |
| InChI | InChI=1S/C15H22N2/c1-2-11-5-6-13(9-14(11)16)17-15-8-10-3-4-12(15)7-10/h5-6,9-10,12,15,17H,2-4,7-8,16H2,1H3 |
| InChIKey | UHPLPATWHHRHIH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|