C15H21N — CID 54595835
N-(3-ethylphenyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 54595835) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(3-ethylphenyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-(3-ethylphenyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 54595835 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-(3-ethylphenyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | CCc1cccc(NC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C15H21N/c1-2-11-4-3-5-14(9-11)16-15-10-12-6-7-13(15)8-12/h3-5,9,12-13,15-16H,2,6-8,10H2,1H3 |
| InChIKey | PMVOQSYHJNMIEO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |