C14H20N2O2S — CID 61310120
N-[3-(2-bicyclo[2.2.1]heptanylamino)phenyl]methanesulfonamide (PubChem CID 61310120) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-[3-(2-bicyclo[2.2.1]heptanylamino)phenyl]methanesulfonamide.
| Compound Name | N-[3-(2-bicyclo[2.2.1]heptanylamino)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 61310120 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[3-(2-bicyclo[2.2.1]heptanylamino)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(NC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C14H20N2O2S/c1-19(17,18)16-13-4-2-3-12(9-13)15-14-8-10-5-6-11(14)7-10/h2-4,9-11,14-16H,5-8H2,1H3 |
| InChIKey | SLQYTRUCWJECGF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |