C15H24N2O2S — CID 64732200
N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide (PubChem CID 64732200) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 64732200 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide |
| SMILES | CC1CCC(Nc2cccc(NS(C)(=O)=O)c2)CC1C |
| InChI | InChI=1S/C15H24N2O2S/c1-11-7-8-14(9-12(11)2)16-13-5-4-6-15(10-13)17-20(3,18)19/h4-6,10-12,14,16-17H,7-9H2,1-3H3 |
| InChIKey | JZJAIQBDNRXFBE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |