About N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide
N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide (PubChem CID 64732200) has the molecular formula C15H24N2O2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide |
| PubChem CID | 64732200 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide |
| SMILES | CC1CCC(Nc2cccc(NS(C)(=O)=O)c2)CC1C |
| InChI | InChI=1S/C15H24N2O2S/c1-11-7-8-14(9-12(11)2)16-13-5-4-6-15(10-13)17-20(3,18)19/h4-6,10-12,14,16-17H,7-9H2,1-3H3 |
| InChIKey | JZJAIQBDNRXFBE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide?
The IUPAC name of N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide (CID 64732200) is N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide?
The canonical SMILES for N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide is CC1CCC(Nc2cccc(NS(C)(=O)=O)c2)CC1C.
What is the InChIKey of N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide?
The InChIKey is JZJAIQBDNRXFBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2S/c1-11-7-8-14(9-12(11)2)16-13-5-4-6-15(10-13)17-20(3,18)19/h4-6,10-12,14,16-17H,7-9H2,1-3H3.
What are the key properties of N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide?
N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide has a molecular weight of 296.44 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3,4-dimethylcyclohexyl)amino]phenyl]methanesulfonamide is sourced from PubChem (CID 64732200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).