C14H20FN — CID 64731978
N-(3,4-dimethylcyclohexyl)-3-fluoroaniline (PubChem CID 64731978) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is N-(3,4-dimethylcyclohexyl)-3-fluoroaniline.
| Compound Name | N-(3,4-dimethylcyclohexyl)-3-fluoroaniline |
|---|---|
| PubChem CID | 64731978 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-(3,4-dimethylcyclohexyl)-3-fluoroaniline |
| SMILES | CC1CCC(Nc2cccc(F)c2)CC1C |
| InChI | InChI=1S/C14H20FN/c1-10-6-7-14(8-11(10)2)16-13-5-3-4-12(15)9-13/h3-5,9-11,14,16H,6-8H2,1-2H3 |
| InChIKey | CNAPUDCHCXYLNL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |