C13H19FN2 — CID 64741980
N-(3,4-dimethylcyclohexyl)-6-fluoropyridin-2-amine (PubChem CID 64741980) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(3,4-dimethylcyclohexyl)-6-fluoropyridin-2-amine.
| Compound Name | N-(3,4-dimethylcyclohexyl)-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 64741980 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-(3,4-dimethylcyclohexyl)-6-fluoropyridin-2-amine |
| SMILES | CC1CCC(Nc2cccc(F)n2)CC1C |
| InChI | InChI=1S/C13H19FN2/c1-9-6-7-11(8-10(9)2)15-13-5-3-4-12(14)16-13/h3-5,9-11H,6-8H2,1-2H3,(H,15,16) |
| InChIKey | PVFJRDJNQUCISW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|