C14H20NNaO5S2 — CID 23664992
sodium N-benzyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamodithioate (PubChem CID 23664992) has the molecular formula C14H20NNaO5S2 and a molecular weight of 369.44 g/mol. Its IUPAC name is sodium N-benzyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamodithioate.
| Compound Name | sodium N-benzyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamodithioate |
|---|---|
| PubChem CID | 23664992 |
| Molecular Formula | C14H20NNaO5S2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | sodium N-benzyl-N-(2,3,4,5,6-pentahydroxyhexyl)carbamodithioate |
| SMILES | OCC(O)C(O)C(O)C(O)CN(Cc1ccccc1)C(=S)[S-].[Na+] |
| InChI | InChI=1S/C14H21NO5S2.Na/c16-8-11(18)13(20)12(19)10(17)7-15(14(21)22)6-9-4-2-1-3-5-9;/h1-5,10-13,16-20H,6-8H2,(H,21,22);/q;+1/p-1 |
| InChIKey | BKOVQKBWCURYNR-UHFFFAOYSA-M |
| XLogP | -4.24 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|