C15H25NO3 — CID 153440075
1-[benzyl(methyl)amino]-5-methylhexane-2,3,4-triol (PubChem CID 153440075) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-[benzyl(methyl)amino]-5-methylhexane-2,3,4-triol.
| Compound Name | 1-[benzyl(methyl)amino]-5-methylhexane-2,3,4-triol |
|---|---|
| PubChem CID | 153440075 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-[benzyl(methyl)amino]-5-methylhexane-2,3,4-triol |
| SMILES | CC(C)C(O)C(O)C(O)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H25NO3/c1-11(2)14(18)15(19)13(17)10-16(3)9-12-7-5-4-6-8-12/h4-8,11,13-15,17-19H,9-10H2,1-3H3 |
| InChIKey | HZZDDBQCUXXMMF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |