C19H25N — CID 162416433
N-benzyl-N,2-dimethyl-4-phenylbutan-1-amine (PubChem CID 162416433) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is N-benzyl-N,2-dimethyl-4-phenylbutan-1-amine.
| Compound Name | N-benzyl-N,2-dimethyl-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 162416433 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-benzyl-N,2-dimethyl-4-phenylbutan-1-amine |
| SMILES | CC(CCc1ccccc1)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H25N/c1-17(13-14-18-9-5-3-6-10-18)15-20(2)16-19-11-7-4-8-12-19/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | SXUTUBSECCCTCI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |