C12H19N — CID 134172295
(2S)-N,2-dimethyl-4-phenylbutan-1-amine (PubChem CID 134172295) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (2S)-N,2-dimethyl-4-phenylbutan-1-amine.
| Compound Name | (2S)-N,2-dimethyl-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 134172295 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2S)-N,2-dimethyl-4-phenylbutan-1-amine |
| SMILES | CNC[C@@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C12H19N/c1-11(10-13-2)8-9-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | ANGWKAIJDYWPKC-NSHDSACASA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |