C18H23N — CID 10586995
N-methyl-1,5-diphenylpentan-3-amine (PubChem CID 10586995) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is N-methyl-1,5-diphenylpentan-3-amine.
| Compound Name | N-methyl-1,5-diphenylpentan-3-amine |
|---|---|
| PubChem CID | 10586995 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-methyl-1,5-diphenylpentan-3-amine |
| SMILES | CNC(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C18H23N/c1-19-18(14-12-16-8-4-2-5-9-16)15-13-17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3 |
| InChIKey | JXHCVIVLHKLOIS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |