About CID 59877545
CID 59877545 (PubChem CID 59877545) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol.
Molecular Properties
| Compound Name | CID 59877545 |
| PubChem CID | 59877545 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | — |
| SMILES | [CH]CC(CCc1ccccc1)NC |
| InChI | InChI=1S/C12H17N/c1-3-12(13-2)10-9-11-7-5-4-6-8-11/h1,4-8,12-13H,3,9-10H2,2H3 |
| InChIKey | YOUIEAJYEHDGGT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59877545 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59877545?
The IUPAC name of CID 59877545 (CID 59877545) is not available.
What is the SMILES notation for CID 59877545?
The canonical SMILES for CID 59877545 is [CH]CC(CCc1ccccc1)NC.
What is the InChIKey of CID 59877545?
The InChIKey is YOUIEAJYEHDGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-3-12(13-2)10-9-11-7-5-4-6-8-11/h1,4-8,12-13H,3,9-10H2,2H3.
What are the key properties of CID 59877545?
CID 59877545 has a molecular weight of 175.28 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59877545 is sourced from PubChem (CID 59877545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).