About acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene
acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene (PubChem CID 143824373) has the molecular formula C19H23
and a molecular weight of 251.39 g/mol. Its IUPAC name is acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene.
Molecular Properties
| Compound Name | acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene |
| PubChem CID | 143824373 |
| Molecular Formula | C19H23 |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene |
| SMILES | C#C.CC(CCc1ccccc1)Cc1ccccc1.[H] |
| InChI | InChI=1S/C17H20.C2H2.H/c1-15(14-17-10-6-3-7-11-17)12-13-16-8-4-2-5-9-16;1-2;/h2-11,15H,12-14H2,1H3;1-2H; |
| InChIKey | CAEOFTYEUGSDLE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene?
The IUPAC name of acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene (CID 143824373) is acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene.
What is the SMILES notation for acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene?
The canonical SMILES for acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene is C#C.CC(CCc1ccccc1)Cc1ccccc1.[H].
What is the InChIKey of acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene?
The InChIKey is CAEOFTYEUGSDLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20.C2H2.H/c1-15(14-17-10-6-3-7-11-17)12-13-16-8-4-2-5-9-16;1-2;/h2-11,15H,12-14H2,1H3;1-2H;.
What are the key properties of acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene?
acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene has a molecular weight of 251.39 g/mol, XLogP of 4.86, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;hydrogen;(2-methyl-4-phenylbutyl)benzene is sourced from PubChem (CID 143824373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).