C20H28N2 — CID 130887110
1-N,2-N-dibenzyl-1-N,3-dimethylbutane-1,2-diamine (PubChem CID 130887110) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-N,2-N-dibenzyl-1-N,3-dimethylbutane-1,2-diamine.
| Compound Name | 1-N,2-N-dibenzyl-1-N,3-dimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 130887110 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-N,2-N-dibenzyl-1-N,3-dimethylbutane-1,2-diamine |
| SMILES | CC(C)C(CN(C)Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C20H28N2/c1-17(2)20(21-14-18-10-6-4-7-11-18)16-22(3)15-19-12-8-5-9-13-19/h4-13,17,20-21H,14-16H2,1-3H3 |
| InChIKey | BCQZJSNMSVZEMK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |