C28H36N2 — CID 14791984
(2S,3S)-2-N,2-N,3-N-tribenzylheptane-2,3-diamine (PubChem CID 14791984) has the molecular formula C28H36N2 and a molecular weight of 400.61 g/mol. Its IUPAC name is (2S,3S)-2-N,2-N,3-N-tribenzylheptane-2,3-diamine.
| Compound Name | (2S,3S)-2-N,2-N,3-N-tribenzylheptane-2,3-diamine |
|---|---|
| PubChem CID | 14791984 |
| Molecular Formula | C28H36N2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | (2S,3S)-2-N,2-N,3-N-tribenzylheptane-2,3-diamine |
| SMILES | CCCC[C@H](NCc1ccccc1)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H36N2/c1-3-4-20-28(29-21-25-14-8-5-9-15-25)24(2)30(22-26-16-10-6-11-17-26)23-27-18-12-7-13-19-27/h5-19,24,28-29H,3-4,20-23H2,1-2H3/t24-,28-/m0/s1 |
| InChIKey | WMSMWAKQKZLTQY-CUBQBAPOSA-N |
| XLogP | 6.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |