C13H22N2 — CID 65385282
2-N-benzylhexane-1,2-diamine (PubChem CID 65385282) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-N-benzylhexane-1,2-diamine.
| Compound Name | 2-N-benzylhexane-1,2-diamine |
|---|---|
| PubChem CID | 65385282 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2-N-benzylhexane-1,2-diamine |
| SMILES | CCCCC(CN)NCc1ccccc1 |
| InChI | InChI=1S/C13H22N2/c1-2-3-9-13(10-14)15-11-12-7-5-4-6-8-12/h4-8,13,15H,2-3,9-11,14H2,1H3 |
| InChIKey | VLWVBDOGUMDHFG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |