C14H25N3O2S — CID 80698399
[1-aminohexan-2-ylsulfamoyl(methyl)amino]methylbenzene (PubChem CID 80698399) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is [1-aminohexan-2-ylsulfamoyl(methyl)amino]methylbenzene.
| Compound Name | [1-aminohexan-2-ylsulfamoyl(methyl)amino]methylbenzene |
|---|---|
| PubChem CID | 80698399 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | [1-aminohexan-2-ylsulfamoyl(methyl)amino]methylbenzene |
| SMILES | CCCCC(CN)NS(=O)(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C14H25N3O2S/c1-3-4-10-14(11-15)16-20(18,19)17(2)12-13-8-6-5-7-9-13/h5-9,14,16H,3-4,10-12,15H2,1-2H3 |
| InChIKey | FXCMZHJUGONYAO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |