C15H28ClN3O2S — CID 119983312
[(1-amino-4-methylpentan-2-yl)sulfamoyl-ethylamino]methylbenzene;hydrochloride (PubChem CID 119983312) has the molecular formula C15H28ClN3O2S and a molecular weight of 349.93 g/mol. Its IUPAC name is [(1-amino-4-methylpentan-2-yl)sulfamoyl-ethylamino]methylbenzene;hydrochloride.
| Compound Name | [(1-amino-4-methylpentan-2-yl)sulfamoyl-ethylamino]methylbenzene;hydrochloride |
|---|---|
| PubChem CID | 119983312 |
| Molecular Formula | C15H28ClN3O2S |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | [(1-amino-4-methylpentan-2-yl)sulfamoyl-ethylamino]methylbenzene;hydrochloride |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)NC(CN)CC(C)C.Cl |
| InChI | InChI=1S/C15H27N3O2S.ClH/c1-4-18(12-14-8-6-5-7-9-14)21(19,20)17-15(11-16)10-13(2)3;/h5-9,13,15,17H,4,10-12,16H2,1-3H3;1H |
| InChIKey | FRJSSIIQTKONPF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |