C13H24ClN3O2S — CID 120825290
[ethyl-[2-(methylamino)propylsulfamoyl]amino]methylbenzene;hydrochloride (PubChem CID 120825290) has the molecular formula C13H24ClN3O2S and a molecular weight of 321.87 g/mol. Its IUPAC name is [ethyl-[2-(methylamino)propylsulfamoyl]amino]methylbenzene;hydrochloride.
| Compound Name | [ethyl-[2-(methylamino)propylsulfamoyl]amino]methylbenzene;hydrochloride |
|---|---|
| PubChem CID | 120825290 |
| Molecular Formula | C13H24ClN3O2S |
| Molecular Weight | 321.87 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | [ethyl-[2-(methylamino)propylsulfamoyl]amino]methylbenzene;hydrochloride |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)NCC(C)NC.Cl |
| InChI | InChI=1S/C13H23N3O2S.ClH/c1-4-16(11-13-8-6-5-7-9-13)19(17,18)15-10-12(2)14-3;/h5-9,12,14-15H,4,10-11H2,1-3H3;1H |
| InChIKey | VBFSFZWXHQIWTE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.87 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |