C19H26N2O4S2 — CID 90121532
N,N'-dibenzyl-N,N'-diethylmethanedisulfonamide (PubChem CID 90121532) has the molecular formula C19H26N2O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is N,N'-dibenzyl-N,N'-diethylmethanedisulfonamide.
| Compound Name | N,N'-dibenzyl-N,N'-diethylmethanedisulfonamide |
|---|---|
| PubChem CID | 90121532 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N,N'-dibenzyl-N,N'-diethylmethanedisulfonamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)CS(=O)(=O)N(CC)Cc1ccccc1 |
| InChI | InChI=1S/C19H26N2O4S2/c1-3-20(15-18-11-7-5-8-12-18)26(22,23)17-27(24,25)21(4-2)16-19-13-9-6-10-14-19/h5-14H,3-4,15-17H2,1-2H3 |
| InChIKey | QTZPOKMIUQHWEH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |