C14H14NNaO3S — CID 141380855
sodium N,N-dibenzylsulfamate (PubChem CID 141380855) has the molecular formula C14H14NNaO3S and a molecular weight of 299.33 g/mol. Its IUPAC name is sodium N,N-dibenzylsulfamate.
| Compound Name | sodium N,N-dibenzylsulfamate |
|---|---|
| PubChem CID | 141380855 |
| Molecular Formula | C14H14NNaO3S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | sodium N,N-dibenzylsulfamate |
| SMILES | O=S(=O)([O-])N(Cc1ccccc1)Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C14H15NO3S.Na/c16-19(17,18)15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;/h1-10H,11-12H2,(H,16,17,18);/q;+1/p-1 |
| InChIKey | QTWHHQBLPJZVIJ-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|