C15H16ClNO2S — CID 63666157
N,N-dibenzyl-1-chloromethanesulfonamide (PubChem CID 63666157) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is N,N-dibenzyl-1-chloromethanesulfonamide.
| Compound Name | N,N-dibenzyl-1-chloromethanesulfonamide |
|---|---|
| PubChem CID | 63666157 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N,N-dibenzyl-1-chloromethanesulfonamide |
| SMILES | O=S(=O)(CCl)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H16ClNO2S/c16-13-20(18,19)17(11-14-7-3-1-4-8-14)12-15-9-5-2-6-10-15/h1-10H,11-13H2 |
| InChIKey | KJBPLNVZAMGPDO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|