C19H17ClN2O2S — CID 2433225
N,N-dibenzyl-6-chloropyridine-3-sulfonamide (PubChem CID 2433225) has the molecular formula C19H17ClN2O2S and a molecular weight of 372.88 g/mol. Its IUPAC name is N,N-dibenzyl-6-chloropyridine-3-sulfonamide.
| Compound Name | N,N-dibenzyl-6-chloropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 2433225 |
| Molecular Formula | C19H17ClN2O2S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N,N-dibenzyl-6-chloropyridine-3-sulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)nc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H17ClN2O2S/c20-19-12-11-18(13-21-19)25(23,24)22(14-16-7-3-1-4-8-16)15-17-9-5-2-6-10-17/h1-13H,14-15H2 |
| InChIKey | SYFRVJLBPHIPGZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|