C26H22F3N3O2S — CID 5268457
N,N-dibenzyl-6-[2-(trifluoromethyl)anilino]pyridine-3-sulfonamide (PubChem CID 5268457) has the molecular formula C26H22F3N3O2S and a molecular weight of 497.54 g/mol. Its IUPAC name is N,N-dibenzyl-6-[2-(trifluoromethyl)anilino]pyridine-3-sulfonamide.
| Compound Name | N,N-dibenzyl-6-[2-(trifluoromethyl)anilino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 5268457 |
| Molecular Formula | C26H22F3N3O2S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N,N-dibenzyl-6-[2-(trifluoromethyl)anilino]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(c1ccc(Nc2ccccc2C(F)(F)F)nc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H22F3N3O2S/c27-26(28,29)23-13-7-8-14-24(23)31-25-16-15-22(17-30-25)35(33,34)32(18-20-9-3-1-4-10-20)19-21-11-5-2-6-12-21/h1-17H,18-19H2,(H,30,31) |
| InChIKey | ROCKVCZLXJDRLJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |