C19H22F3N3O — CID 109161899
N,N-dipropyl-6-[2-(trifluoromethyl)anilino]pyridine-3-carboxamide (PubChem CID 109161899) has the molecular formula C19H22F3N3O and a molecular weight of 365.40 g/mol. Its IUPAC name is N,N-dipropyl-6-[2-(trifluoromethyl)anilino]pyridine-3-carboxamide.
| Compound Name | N,N-dipropyl-6-[2-(trifluoromethyl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109161899 |
| Molecular Formula | C19H22F3N3O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N,N-dipropyl-6-[2-(trifluoromethyl)anilino]pyridine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(Nc2ccccc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C19H22F3N3O/c1-3-11-25(12-4-2)18(26)14-9-10-17(23-13-14)24-16-8-6-5-7-15(16)19(20,21)22/h5-10,13H,3-4,11-12H2,1-2H3,(H,23,24) |
| InChIKey | QPXVOZKIUPJBSE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |