C20H27N3O — CID 109161876
6-(2-ethylanilino)-N,N-dipropylpyridine-3-carboxamide (PubChem CID 109161876) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 6-(2-ethylanilino)-N,N-dipropylpyridine-3-carboxamide.
| Compound Name | 6-(2-ethylanilino)-N,N-dipropylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109161876 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 6-(2-ethylanilino)-N,N-dipropylpyridine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(Nc2ccccc2CC)nc1 |
| InChI | InChI=1S/C20H27N3O/c1-4-13-23(14-5-2)20(24)17-11-12-19(21-15-17)22-18-10-8-7-9-16(18)6-3/h7-12,15H,4-6,13-14H2,1-3H3,(H,21,22) |
| InChIKey | GCBRZEXIPWPYOT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |