C19H26N4O — CID 109126232
6-(2-ethylanilino)-N,N-dipropylpyridazine-3-carboxamide (PubChem CID 109126232) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 6-(2-ethylanilino)-N,N-dipropylpyridazine-3-carboxamide.
| Compound Name | 6-(2-ethylanilino)-N,N-dipropylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109126232 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 6-(2-ethylanilino)-N,N-dipropylpyridazine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(Nc2ccccc2CC)nn1 |
| InChI | InChI=1S/C19H26N4O/c1-4-13-23(14-5-2)19(24)17-11-12-18(22-21-17)20-16-10-8-7-9-15(16)6-3/h7-12H,4-6,13-14H2,1-3H3,(H,20,22) |
| InChIKey | SQUIAEKVHLOOKO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |